About 2-phenoxyethyl 3-[2-(4-phenylphenoxy)butanoyloxy]benzoate
2-phenoxyethyl 3-[2-(4-phenylphenoxy)butanoyloxy]benzoate (PubChem CID 17161902) has the molecular formula C31H28O6
and a molecular weight of 496.56 g/mol. Its IUPAC name is 2-phenoxyethyl 3-[2-(4-phenylphenoxy)butanoyloxy]benzoate.
Molecular Properties
| Compound Name | 2-phenoxyethyl 3-[2-(4-phenylphenoxy)butanoyloxy]benzoate |
| PubChem CID | 17161902 |
| Molecular Formula | C31H28O6 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 2-phenoxyethyl 3-[2-(4-phenylphenoxy)butanoyloxy]benzoate |
| SMILES | CCC(Oc1ccc(-c2ccccc2)cc1)C(=O)Oc1cccc(C(=O)OCCOc2ccccc2)c1 |
| InChI | InChI=1S/C31H28O6/c1-2-29(36-27-18-16-24(17-19-27)23-10-5-3-6-11-23)31(33)37-28-15-9-12-25(22-28)30(32)35-21-20-34-26-13-7-4-8-14-26/h3-19,22,29H,2,20-21H2,1H3 |
| InChIKey | WJCSSQDLNVKBMW-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 2-phenoxyethyl 3-[2-(4-phenylphenoxy)butanoyloxy]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenoxyethyl 3-[2-(4-phenylphenoxy)butanoyloxy]benzoate?
The IUPAC name of 2-phenoxyethyl 3-[2-(4-phenylphenoxy)butanoyloxy]benzoate (CID 17161902) is 2-phenoxyethyl 3-[2-(4-phenylphenoxy)butanoyloxy]benzoate.
What is the SMILES notation for 2-phenoxyethyl 3-[2-(4-phenylphenoxy)butanoyloxy]benzoate?
The canonical SMILES for 2-phenoxyethyl 3-[2-(4-phenylphenoxy)butanoyloxy]benzoate is CCC(Oc1ccc(-c2ccccc2)cc1)C(=O)Oc1cccc(C(=O)OCCOc2ccccc2)c1.
What is the InChIKey of 2-phenoxyethyl 3-[2-(4-phenylphenoxy)butanoyloxy]benzoate?
The InChIKey is WJCSSQDLNVKBMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H28O6/c1-2-29(36-27-18-16-24(17-19-27)23-10-5-3-6-11-23)31(33)37-28-15-9-12-25(22-28)30(32)35-21-20-34-26-13-7-4-8-14-26/h3-19,22,29H,2,20-21H2,1H3.
What are the key properties of 2-phenoxyethyl 3-[2-(4-phenylphenoxy)butanoyloxy]benzoate?
2-phenoxyethyl 3-[2-(4-phenylphenoxy)butanoyloxy]benzoate has a molecular weight of 496.56 g/mol, XLogP of 6.35, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenoxyethyl 3-[2-(4-phenylphenoxy)butanoyloxy]benzoate is sourced from PubChem (CID 17161902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).