C22H23BrFNO3 — CID 88582085
phenyl 3-bromo-2-butoxy-4-(3,4-dihydro-2H-pyrrol-5-yl)-5-fluoro-6-methylbenzoate (PubChem CID 88582085) has the molecular formula C22H23BrFNO3 and a molecular weight of 448.33 g/mol. Its IUPAC name is phenyl 3-bromo-2-butoxy-4-(3,4-dihydro-2H-pyrrol-5-yl)-5-fluoro-6-methylbenzoate.
| Compound Name | phenyl 3-bromo-2-butoxy-4-(3,4-dihydro-2H-pyrrol-5-yl)-5-fluoro-6-methylbenzoate |
|---|---|
| PubChem CID | 88582085 |
| Molecular Formula | C22H23BrFNO3 |
| Molecular Weight | 448.33 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | phenyl 3-bromo-2-butoxy-4-(3,4-dihydro-2H-pyrrol-5-yl)-5-fluoro-6-methylbenzoate |
| SMILES | CCCCOc1c(Br)c(C2=NCCC2)c(F)c(C)c1C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C22H23BrFNO3/c1-3-4-13-27-21-17(22(26)28-15-9-6-5-7-10-15)14(2)20(24)18(19(21)23)16-11-8-12-25-16/h5-7,9-10H,3-4,8,11-13H2,1-2H3 |
| InChIKey | FLCYVOYGIRNECX-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.33 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|