C19H18BrF3O4 — CID 88581829
phenyl 4-bromo-6-butoxy-2-methyl-3-(trifluoromethoxy)benzoate (PubChem CID 88581829) has the molecular formula C19H18BrF3O4 and a molecular weight of 447.25 g/mol. Its IUPAC name is phenyl 4-bromo-6-butoxy-2-methyl-3-(trifluoromethoxy)benzoate.
| Compound Name | phenyl 4-bromo-6-butoxy-2-methyl-3-(trifluoromethoxy)benzoate |
|---|---|
| PubChem CID | 88581829 |
| Molecular Formula | C19H18BrF3O4 |
| Molecular Weight | 447.25 g/mol |
| Exact Mass | 446.03 |
| IUPAC Name | phenyl 4-bromo-6-butoxy-2-methyl-3-(trifluoromethoxy)benzoate |
| SMILES | CCCCOc1cc(Br)c(OC(F)(F)F)c(C)c1C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C19H18BrF3O4/c1-3-4-10-25-15-11-14(20)17(27-19(21,22)23)12(2)16(15)18(24)26-13-8-6-5-7-9-13/h5-9,11H,3-4,10H2,1-2H3 |
| InChIKey | SOWPZFBVLYEBID-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.25 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|