C26H32F3NO4 — CID 88581960
phenyl 6-butoxy-2-methyl-4-(4-propan-2-ylmorpholin-3-yl)-3-(trifluoromethyl)benzoate (PubChem CID 88581960) has the molecular formula C26H32F3NO4 and a molecular weight of 479.54 g/mol. Its IUPAC name is phenyl 6-butoxy-2-methyl-4-(4-propan-2-ylmorpholin-3-yl)-3-(trifluoromethyl)benzoate.
| Compound Name | phenyl 6-butoxy-2-methyl-4-(4-propan-2-ylmorpholin-3-yl)-3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 88581960 |
| Molecular Formula | C26H32F3NO4 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | phenyl 6-butoxy-2-methyl-4-(4-propan-2-ylmorpholin-3-yl)-3-(trifluoromethyl)benzoate |
| SMILES | CCCCOc1cc(C2COCCN2C(C)C)c(C(F)(F)F)c(C)c1C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C26H32F3NO4/c1-5-6-13-33-22-15-20(21-16-32-14-12-30(21)17(2)3)24(26(27,28)29)18(4)23(22)25(31)34-19-10-8-7-9-11-19/h7-11,15,17,21H,5-6,12-14,16H2,1-4H3 |
| InChIKey | ROJIPPGDNICQCJ-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|