C29H40N2O5 — CID 88581864
tert-butyl 2-[5-butoxy-2-(dimethylamino)-3-methyl-4-phenoxycarbonylphenyl]pyrrolidine-1-carboxylate (PubChem CID 88581864) has the molecular formula C29H40N2O5 and a molecular weight of 496.65 g/mol. Its IUPAC name is tert-butyl 2-[5-butoxy-2-(dimethylamino)-3-methyl-4-phenoxycarbonylphenyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[5-butoxy-2-(dimethylamino)-3-methyl-4-phenoxycarbonylphenyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 88581864 |
| Molecular Formula | C29H40N2O5 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.29 |
| IUPAC Name | tert-butyl 2-[5-butoxy-2-(dimethylamino)-3-methyl-4-phenoxycarbonylphenyl]pyrrolidine-1-carboxylate |
| SMILES | CCCCOc1cc(C2CCCN2C(=O)OC(C)(C)C)c(N(C)C)c(C)c1C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C29H40N2O5/c1-8-9-18-34-24-19-22(23-16-13-17-31(23)28(33)36-29(3,4)5)26(30(6)7)20(2)25(24)27(32)35-21-14-11-10-12-15-21/h10-12,14-15,19,23H,8-9,13,16-18H2,1-7H3 |
| InChIKey | PUXDAWPBWKUVJG-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|