C22H27NO4 — CID 134955481
phenyl 4-[(2S)-1-ethylpyrrolidin-2-yl]-3,6-dimethoxy-2-methylbenzoate (PubChem CID 134955481) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is phenyl 4-[(2S)-1-ethylpyrrolidin-2-yl]-3,6-dimethoxy-2-methylbenzoate.
| Compound Name | phenyl 4-[(2S)-1-ethylpyrrolidin-2-yl]-3,6-dimethoxy-2-methylbenzoate |
|---|---|
| PubChem CID | 134955481 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | phenyl 4-[(2S)-1-ethylpyrrolidin-2-yl]-3,6-dimethoxy-2-methylbenzoate |
| SMILES | CCN1CCC[C@H]1c1cc(OC)c(C(=O)Oc2ccccc2)c(C)c1OC |
| InChI | InChI=1S/C22H27NO4/c1-5-23-13-9-12-18(23)17-14-19(25-3)20(15(2)21(17)26-4)22(24)27-16-10-7-6-8-11-16/h6-8,10-11,14,18H,5,9,12-13H2,1-4H3/t18-/m0/s1 |
| InChIKey | YTZVNCNNPPJVBR-SFHVURJKSA-N |
| XLogP | 4.39 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|