C20H23NO4 — CID 167336015
phenyl 4-[(2S)-1-ethylpyrrolidin-2-yl]-3,6-dihydroxy-2-methylbenzoate (PubChem CID 167336015) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is phenyl 4-[(2S)-1-ethylpyrrolidin-2-yl]-3,6-dihydroxy-2-methylbenzoate.
| Compound Name | phenyl 4-[(2S)-1-ethylpyrrolidin-2-yl]-3,6-dihydroxy-2-methylbenzoate |
|---|---|
| PubChem CID | 167336015 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | phenyl 4-[(2S)-1-ethylpyrrolidin-2-yl]-3,6-dihydroxy-2-methylbenzoate |
| SMILES | CCN1CCC[C@H]1c1cc(O)c(C(=O)Oc2ccccc2)c(C)c1O |
| InChI | InChI=1S/C20H23NO4/c1-3-21-11-7-10-16(21)15-12-17(22)18(13(2)19(15)23)20(24)25-14-8-5-4-6-9-14/h4-6,8-9,12,16,22-23H,3,7,10-11H2,1-2H3/t16-/m0/s1 |
| InChIKey | OXIWGCBZRHMLCE-INIZCTEOSA-N |
| XLogP | 3.78 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|