C27H32F3NO4 — CID 88582018
phenyl 6-butoxy-2-methyl-4-(1-prop-2-enylpiperidin-2-yl)-3-(trifluoromethoxy)benzoate (PubChem CID 88582018) has the molecular formula C27H32F3NO4 and a molecular weight of 491.55 g/mol. Its IUPAC name is phenyl 6-butoxy-2-methyl-4-(1-prop-2-enylpiperidin-2-yl)-3-(trifluoromethoxy)benzoate.
| Compound Name | phenyl 6-butoxy-2-methyl-4-(1-prop-2-enylpiperidin-2-yl)-3-(trifluoromethoxy)benzoate |
|---|---|
| PubChem CID | 88582018 |
| Molecular Formula | C27H32F3NO4 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | phenyl 6-butoxy-2-methyl-4-(1-prop-2-enylpiperidin-2-yl)-3-(trifluoromethoxy)benzoate |
| SMILES | C=CCN1CCCCC1c1cc(OCCCC)c(C(=O)Oc2ccccc2)c(C)c1OC(F)(F)F |
| InChI | InChI=1S/C27H32F3NO4/c1-4-6-17-33-23-18-21(22-14-10-11-16-31(22)15-5-2)25(35-27(28,29)30)19(3)24(23)26(32)34-20-12-8-7-9-13-20/h5,7-9,12-13,18,22H,2,4,6,10-11,14-17H2,1,3H3 |
| InChIKey | CPABFTFZQBSLSW-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|