C18H21NO3 — CID 121290129
phenyl 5-butoxy-2,3-dimethylpyridine-4-carboxylate (PubChem CID 121290129) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is phenyl 5-butoxy-2,3-dimethylpyridine-4-carboxylate.
| Compound Name | phenyl 5-butoxy-2,3-dimethylpyridine-4-carboxylate |
|---|---|
| PubChem CID | 121290129 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | phenyl 5-butoxy-2,3-dimethylpyridine-4-carboxylate |
| SMILES | CCCCOc1cnc(C)c(C)c1C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C18H21NO3/c1-4-5-11-21-16-12-19-14(3)13(2)17(16)18(20)22-15-9-7-6-8-10-15/h6-10,12H,4-5,11H2,1-3H3 |
| InChIKey | GDFMWZQOWSGOMV-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|