C24H28F3NO5 — CID 88582044
phenyl 4-(5-aminopentanoyl)-6-butoxy-2-methyl-3-(trifluoromethoxy)benzoate (PubChem CID 88582044) has the molecular formula C24H28F3NO5 and a molecular weight of 467.48 g/mol. Its IUPAC name is phenyl 4-(5-aminopentanoyl)-6-butoxy-2-methyl-3-(trifluoromethoxy)benzoate.
| Compound Name | phenyl 4-(5-aminopentanoyl)-6-butoxy-2-methyl-3-(trifluoromethoxy)benzoate |
|---|---|
| PubChem CID | 88582044 |
| Molecular Formula | C24H28F3NO5 |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | phenyl 4-(5-aminopentanoyl)-6-butoxy-2-methyl-3-(trifluoromethoxy)benzoate |
| SMILES | CCCCOc1cc(C(=O)CCCCN)c(OC(F)(F)F)c(C)c1C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C24H28F3NO5/c1-3-4-14-31-20-15-18(19(29)12-8-9-13-28)22(33-24(25,26)27)16(2)21(20)23(30)32-17-10-6-5-7-11-17/h5-7,10-11,15H,3-4,8-9,12-14,28H2,1-2H3 |
| InChIKey | MDIQYQCGHMNNIV-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|