C23H18F3IO4 — CID 138509489
phenyl 4-iodo-2,5-dimethyl-6-phenylmethoxy-3-(trifluoromethoxy)benzoate (PubChem CID 138509489) has the molecular formula C23H18F3IO4 and a molecular weight of 542.29 g/mol. Its IUPAC name is phenyl 4-iodo-2,5-dimethyl-6-phenylmethoxy-3-(trifluoromethoxy)benzoate.
| Compound Name | phenyl 4-iodo-2,5-dimethyl-6-phenylmethoxy-3-(trifluoromethoxy)benzoate |
|---|---|
| PubChem CID | 138509489 |
| Molecular Formula | C23H18F3IO4 |
| Molecular Weight | 542.29 g/mol |
| Exact Mass | 542.02 |
| IUPAC Name | phenyl 4-iodo-2,5-dimethyl-6-phenylmethoxy-3-(trifluoromethoxy)benzoate |
| SMILES | Cc1c(I)c(OC(F)(F)F)c(C)c(C(=O)Oc2ccccc2)c1OCc1ccccc1 |
| InChI | InChI=1S/C23H18F3IO4/c1-14-18(22(28)30-17-11-7-4-8-12-17)20(29-13-16-9-5-3-6-10-16)15(2)19(27)21(14)31-23(24,25)26/h3-12H,13H2,1-2H3 |
| InChIKey | IEPQIWOHFDQKCD-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.29 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|