C26H27FO4 — CID 121288066
phenyl 3-fluoro-4-(2-hydroxybutyl)-2,5-dimethyl-6-phenylmethoxybenzoate (PubChem CID 121288066) has the molecular formula C26H27FO4 and a molecular weight of 422.50 g/mol. Its IUPAC name is phenyl 3-fluoro-4-(2-hydroxybutyl)-2,5-dimethyl-6-phenylmethoxybenzoate.
| Compound Name | phenyl 3-fluoro-4-(2-hydroxybutyl)-2,5-dimethyl-6-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 121288066 |
| Molecular Formula | C26H27FO4 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | phenyl 3-fluoro-4-(2-hydroxybutyl)-2,5-dimethyl-6-phenylmethoxybenzoate |
| SMILES | CCC(O)Cc1c(C)c(OCc2ccccc2)c(C(=O)Oc2ccccc2)c(C)c1F |
| InChI | InChI=1S/C26H27FO4/c1-4-20(28)15-22-17(2)25(30-16-19-11-7-5-8-12-19)23(18(3)24(22)27)26(29)31-21-13-9-6-10-14-21/h5-14,20,28H,4,15-16H2,1-3H3 |
| InChIKey | VLDYXKICMCCCSF-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|