C26H24FNO3 — CID 58493260
phenyl 7-fluoro-6-methyl-4-phenylmethoxy-2-prop-2-enyl-1,3-dihydroisoindole-5-carboxylate (PubChem CID 58493260) has the molecular formula C26H24FNO3 and a molecular weight of 417.48 g/mol. Its IUPAC name is phenyl 7-fluoro-6-methyl-4-phenylmethoxy-2-prop-2-enyl-1,3-dihydroisoindole-5-carboxylate.
| Compound Name | phenyl 7-fluoro-6-methyl-4-phenylmethoxy-2-prop-2-enyl-1,3-dihydroisoindole-5-carboxylate |
|---|---|
| PubChem CID | 58493260 |
| Molecular Formula | C26H24FNO3 |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | phenyl 7-fluoro-6-methyl-4-phenylmethoxy-2-prop-2-enyl-1,3-dihydroisoindole-5-carboxylate |
| SMILES | C=CCN1Cc2c(F)c(C)c(C(=O)Oc3ccccc3)c(OCc3ccccc3)c2C1 |
| InChI | InChI=1S/C26H24FNO3/c1-3-14-28-15-21-22(16-28)25(30-17-19-10-6-4-7-11-19)23(18(2)24(21)27)26(29)31-20-12-8-5-9-13-20/h3-13H,1,14-17H2,2H3 |
| InChIKey | CDPFCMAOYVTHNY-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|