C28H30FNO3 — CID 58493398
phenyl 2-[(2S)-butan-2-yl]-8-fluoro-7-methyl-5-phenylmethoxy-3,4-dihydro-1H-isoquinoline-6-carboxylate (PubChem CID 58493398) has the molecular formula C28H30FNO3 and a molecular weight of 447.55 g/mol. Its IUPAC name is phenyl 2-[(2S)-butan-2-yl]-8-fluoro-7-methyl-5-phenylmethoxy-3,4-dihydro-1H-isoquinoline-6-carboxylate.
| Compound Name | phenyl 2-[(2S)-butan-2-yl]-8-fluoro-7-methyl-5-phenylmethoxy-3,4-dihydro-1H-isoquinoline-6-carboxylate |
|---|---|
| PubChem CID | 58493398 |
| Molecular Formula | C28H30FNO3 |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | phenyl 2-[(2S)-butan-2-yl]-8-fluoro-7-methyl-5-phenylmethoxy-3,4-dihydro-1H-isoquinoline-6-carboxylate |
| SMILES | CC[C@H](C)N1CCc2c(c(F)c(C)c(C(=O)Oc3ccccc3)c2OCc2ccccc2)C1 |
| InChI | InChI=1S/C28H30FNO3/c1-4-19(2)30-16-15-23-24(17-30)26(29)20(3)25(28(31)33-22-13-9-6-10-14-22)27(23)32-18-21-11-7-5-8-12-21/h5-14,19H,4,15-18H2,1-3H3/t19-/m0/s1 |
| InChIKey | KHSGLPODUCLUJD-IBGZPJMESA-N |
| XLogP | 6.09 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|