C24H30FNO3 — CID 70667248
phenyl 2-[(2R)-butan-2-yl]-4-butoxy-7-fluoro-6-methyl-1,3-dihydroisoindole-5-carboxylate (PubChem CID 70667248) has the molecular formula C24H30FNO3 and a molecular weight of 399.51 g/mol. Its IUPAC name is phenyl 2-[(2R)-butan-2-yl]-4-butoxy-7-fluoro-6-methyl-1,3-dihydroisoindole-5-carboxylate.
| Compound Name | phenyl 2-[(2R)-butan-2-yl]-4-butoxy-7-fluoro-6-methyl-1,3-dihydroisoindole-5-carboxylate |
|---|---|
| PubChem CID | 70667248 |
| Molecular Formula | C24H30FNO3 |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | phenyl 2-[(2R)-butan-2-yl]-4-butoxy-7-fluoro-6-methyl-1,3-dihydroisoindole-5-carboxylate |
| SMILES | CCCCOc1c2c(c(F)c(C)c1C(=O)Oc1ccccc1)CN([C@H](C)CC)C2 |
| InChI | InChI=1S/C24H30FNO3/c1-5-7-13-28-23-20-15-26(16(3)6-2)14-19(20)22(25)17(4)21(23)24(27)29-18-11-9-8-10-12-18/h8-12,16H,5-7,13-15H2,1-4H3/t16-/m1/s1 |
| InChIKey | DHUIPZVIUIJRMV-MRXNPFEDSA-N |
| XLogP | 5.65 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|