C26H26FNO4 — CID 129054023
phenyl 7-fluoro-2-(2-methoxyethyl)-6-methyl-4-phenylmethoxy-1,3-dihydroisoindole-5-carboxylate (PubChem CID 129054023) has the molecular formula C26H26FNO4 and a molecular weight of 435.50 g/mol. Its IUPAC name is phenyl 7-fluoro-2-(2-methoxyethyl)-6-methyl-4-phenylmethoxy-1,3-dihydroisoindole-5-carboxylate.
| Compound Name | phenyl 7-fluoro-2-(2-methoxyethyl)-6-methyl-4-phenylmethoxy-1,3-dihydroisoindole-5-carboxylate |
|---|---|
| PubChem CID | 129054023 |
| Molecular Formula | C26H26FNO4 |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | phenyl 7-fluoro-2-(2-methoxyethyl)-6-methyl-4-phenylmethoxy-1,3-dihydroisoindole-5-carboxylate |
| SMILES | COCCN1Cc2c(F)c(C)c(C(=O)Oc3ccccc3)c(OCc3ccccc3)c2C1 |
| InChI | InChI=1S/C26H26FNO4/c1-18-23(26(29)32-20-11-7-4-8-12-20)25(31-17-19-9-5-3-6-10-19)22-16-28(13-14-30-2)15-21(22)24(18)27/h3-12H,13-17H2,1-2H3 |
| InChIKey | WDUKETHUOHNMIV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|