C23H19Cl2FO3 — CID 58493226
phenyl 4,5-bis(chloromethyl)-3-fluoro-2-methyl-6-phenylmethoxybenzoate (PubChem CID 58493226) has the molecular formula C23H19Cl2FO3 and a molecular weight of 433.31 g/mol. Its IUPAC name is phenyl 4,5-bis(chloromethyl)-3-fluoro-2-methyl-6-phenylmethoxybenzoate.
| Compound Name | phenyl 4,5-bis(chloromethyl)-3-fluoro-2-methyl-6-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 58493226 |
| Molecular Formula | C23H19Cl2FO3 |
| Molecular Weight | 433.31 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | phenyl 4,5-bis(chloromethyl)-3-fluoro-2-methyl-6-phenylmethoxybenzoate |
| SMILES | Cc1c(F)c(CCl)c(CCl)c(OCc2ccccc2)c1C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C23H19Cl2FO3/c1-15-20(23(27)29-17-10-6-3-7-11-17)22(19(13-25)18(12-24)21(15)26)28-14-16-8-4-2-5-9-16/h2-11H,12-14H2,1H3 |
| InChIKey | AGORYHDPKIFBEN-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.31 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|