C29H30FNO3 — CID 58493277
phenyl 2-cyclopentyl-5-fluoro-6-methyl-8-phenylmethoxy-3,4-dihydro-1H-isoquinoline-7-carboxylate (PubChem CID 58493277) has the molecular formula C29H30FNO3 and a molecular weight of 459.56 g/mol. Its IUPAC name is phenyl 2-cyclopentyl-5-fluoro-6-methyl-8-phenylmethoxy-3,4-dihydro-1H-isoquinoline-7-carboxylate.
| Compound Name | phenyl 2-cyclopentyl-5-fluoro-6-methyl-8-phenylmethoxy-3,4-dihydro-1H-isoquinoline-7-carboxylate |
|---|---|
| PubChem CID | 58493277 |
| Molecular Formula | C29H30FNO3 |
| Molecular Weight | 459.56 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | phenyl 2-cyclopentyl-5-fluoro-6-methyl-8-phenylmethoxy-3,4-dihydro-1H-isoquinoline-7-carboxylate |
| SMILES | Cc1c(F)c2c(c(OCc3ccccc3)c1C(=O)Oc1ccccc1)CN(C1CCCC1)CC2 |
| InChI | InChI=1S/C29H30FNO3/c1-20-26(29(32)34-23-14-6-3-7-15-23)28(33-19-21-10-4-2-5-11-21)25-18-31(22-12-8-9-13-22)17-16-24(25)27(20)30/h2-7,10-11,14-15,22H,8-9,12-13,16-19H2,1H3 |
| InChIKey | VDMFYKHRNGYDNS-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.56 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|