C23H28FNO4 — CID 70667225
phenyl 4-butoxy-7-fluoro-2-(2-methoxyethyl)-6-methyl-1,3-dihydroisoindole-5-carboxylate (PubChem CID 70667225) has the molecular formula C23H28FNO4 and a molecular weight of 401.48 g/mol. Its IUPAC name is phenyl 4-butoxy-7-fluoro-2-(2-methoxyethyl)-6-methyl-1,3-dihydroisoindole-5-carboxylate.
| Compound Name | phenyl 4-butoxy-7-fluoro-2-(2-methoxyethyl)-6-methyl-1,3-dihydroisoindole-5-carboxylate |
|---|---|
| PubChem CID | 70667225 |
| Molecular Formula | C23H28FNO4 |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | phenyl 4-butoxy-7-fluoro-2-(2-methoxyethyl)-6-methyl-1,3-dihydroisoindole-5-carboxylate |
| SMILES | CCCCOc1c2c(c(F)c(C)c1C(=O)Oc1ccccc1)CN(CCOC)C2 |
| InChI | InChI=1S/C23H28FNO4/c1-4-5-12-28-22-19-15-25(11-13-27-3)14-18(19)21(24)16(2)20(22)23(26)29-17-9-7-6-8-10-17/h6-10H,4-5,11-15H2,1-3H3 |
| InChIKey | SAICWHMXDUJWHF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|