C25H33NO4 — CID 70667245
phenyl 2-[(2R)-butan-2-yl]-4-butoxy-7-methoxy-6-methyl-1,3-dihydroisoindole-5-carboxylate (PubChem CID 70667245) has the molecular formula C25H33NO4 and a molecular weight of 411.54 g/mol. Its IUPAC name is phenyl 2-[(2R)-butan-2-yl]-4-butoxy-7-methoxy-6-methyl-1,3-dihydroisoindole-5-carboxylate.
| Compound Name | phenyl 2-[(2R)-butan-2-yl]-4-butoxy-7-methoxy-6-methyl-1,3-dihydroisoindole-5-carboxylate |
|---|---|
| PubChem CID | 70667245 |
| Molecular Formula | C25H33NO4 |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | phenyl 2-[(2R)-butan-2-yl]-4-butoxy-7-methoxy-6-methyl-1,3-dihydroisoindole-5-carboxylate |
| SMILES | CCCCOc1c2c(c(OC)c(C)c1C(=O)Oc1ccccc1)CN([C@H](C)CC)C2 |
| InChI | InChI=1S/C25H33NO4/c1-6-8-14-29-24-21-16-26(17(3)7-2)15-20(21)23(28-5)18(4)22(24)25(27)30-19-12-10-9-11-13-19/h9-13,17H,6-8,14-16H2,1-5H3/t17-/m1/s1 |
| InChIKey | RXTPEHQFDTVIJB-QGZVFWFLSA-N |
| XLogP | 5.52 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|