C28H31NO4 — CID 126664130
phenyl 3-methoxy-2-methyl-6-phenylmethoxy-4-(1-pyrrolidin-1-ylethyl)benzoate (PubChem CID 126664130) has the molecular formula C28H31NO4 and a molecular weight of 445.56 g/mol. Its IUPAC name is phenyl 3-methoxy-2-methyl-6-phenylmethoxy-4-(1-pyrrolidin-1-ylethyl)benzoate.
| Compound Name | phenyl 3-methoxy-2-methyl-6-phenylmethoxy-4-(1-pyrrolidin-1-ylethyl)benzoate |
|---|---|
| PubChem CID | 126664130 |
| Molecular Formula | C28H31NO4 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | phenyl 3-methoxy-2-methyl-6-phenylmethoxy-4-(1-pyrrolidin-1-ylethyl)benzoate |
| SMILES | COc1c(C(C)N2CCCC2)cc(OCc2ccccc2)c(C(=O)Oc2ccccc2)c1C |
| InChI | InChI=1S/C28H31NO4/c1-20-26(28(30)33-23-14-8-5-9-15-23)25(32-19-22-12-6-4-7-13-22)18-24(27(20)31-3)21(2)29-16-10-11-17-29/h4-9,12-15,18,21H,10-11,16-17,19H2,1-3H3 |
| InChIKey | GPGBLKVGDXIQJN-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|