C25H26O6 — CID 167335933
phenyl 4-(1,3-dihydroxypropan-2-yl)-3-methoxy-2-methyl-6-phenylmethoxybenzoate (PubChem CID 167335933) has the molecular formula C25H26O6 and a molecular weight of 422.48 g/mol. Its IUPAC name is phenyl 4-(1,3-dihydroxypropan-2-yl)-3-methoxy-2-methyl-6-phenylmethoxybenzoate.
| Compound Name | phenyl 4-(1,3-dihydroxypropan-2-yl)-3-methoxy-2-methyl-6-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 167335933 |
| Molecular Formula | C25H26O6 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | phenyl 4-(1,3-dihydroxypropan-2-yl)-3-methoxy-2-methyl-6-phenylmethoxybenzoate |
| SMILES | COc1c(C(CO)CO)cc(OCc2ccccc2)c(C(=O)Oc2ccccc2)c1C |
| InChI | InChI=1S/C25H26O6/c1-17-23(25(28)31-20-11-7-4-8-12-20)22(30-16-18-9-5-3-6-10-18)13-21(24(17)29-2)19(14-26)15-27/h3-13,19,26-27H,14-16H2,1-2H3 |
| InChIKey | CBMOXOJZGKGVKW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|