C32H38FNO4 — CID 58493309
phenyl 3-fluoro-4-[[[(2R)-1-hydroxy-4-methylpentan-2-yl]-prop-2-enylamino]methyl]-2,5-dimethyl-6-phenylmethoxybenzoate (PubChem CID 58493309) has the molecular formula C32H38FNO4 and a molecular weight of 519.66 g/mol. Its IUPAC name is phenyl 3-fluoro-4-[[[(2R)-1-hydroxy-4-methylpentan-2-yl]-prop-2-enylamino]methyl]-2,5-dimethyl-6-phenylmethoxybenzoate.
| Compound Name | phenyl 3-fluoro-4-[[[(2R)-1-hydroxy-4-methylpentan-2-yl]-prop-2-enylamino]methyl]-2,5-dimethyl-6-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 58493309 |
| Molecular Formula | C32H38FNO4 |
| Molecular Weight | 519.66 g/mol |
| Exact Mass | 519.28 |
| IUPAC Name | phenyl 3-fluoro-4-[[[(2R)-1-hydroxy-4-methylpentan-2-yl]-prop-2-enylamino]methyl]-2,5-dimethyl-6-phenylmethoxybenzoate |
| SMILES | C=CCN(Cc1c(C)c(OCc2ccccc2)c(C(=O)Oc2ccccc2)c(C)c1F)[C@@H](CO)CC(C)C |
| InChI | InChI=1S/C32H38FNO4/c1-6-17-34(26(20-35)18-22(2)3)19-28-23(4)31(37-21-25-13-9-7-10-14-25)29(24(5)30(28)33)32(36)38-27-15-11-8-12-16-27/h6-16,22,26,35H,1,17-21H2,2-5H3/t26-/m1/s1 |
| InChIKey | BOVHILBZEQTXHX-AREMUKBSSA-N |
| XLogP | 6.64 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.66 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|