C37H51FN2O9 — CID 90005223
3-[2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-butoxy-6-fluoro-5-methyl-4-phenoxycarbonylphenyl]-2-[prop-2-enyl(propyl)amino]propanoic acid (PubChem CID 90005223) has the molecular formula C37H51FN2O9 and a molecular weight of 686.82 g/mol. Its IUPAC name is 3-[2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-butoxy-6-fluoro-5-methyl-4-phenoxycarbonylphenyl]-2-[prop-2-enyl(propyl)amino]propanoic acid.
| Compound Name | 3-[2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-butoxy-6-fluoro-5-methyl-4-phenoxycarbonylphenyl]-2-[prop-2-enyl(propyl)amino]propanoic acid |
|---|---|
| PubChem CID | 90005223 |
| Molecular Formula | C37H51FN2O9 |
| Molecular Weight | 686.82 g/mol |
| Exact Mass | 686.36 |
| IUPAC Name | 3-[2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-butoxy-6-fluoro-5-methyl-4-phenoxycarbonylphenyl]-2-[prop-2-enyl(propyl)amino]propanoic acid |
| SMILES | C=CCN(CCC)C(Cc1c(F)c(C)c(C(=O)Oc2ccccc2)c(OCCCC)c1N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C37H51FN2O9/c1-11-14-22-46-31-28(33(43)47-25-18-16-15-17-19-25)24(4)29(38)26(23-27(32(41)42)39(20-12-2)21-13-3)30(31)40(34(44)48-36(5,6)7)35(45)49-37(8,9)10/h12,15-19,27H,2,11,13-14,20-23H2,1,3-10H3,(H,41,42) |
| InChIKey | OVASNIYSKPPLQI-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 131.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.82 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|