C14H15F4NO3 — CID 174645138
2-[2-[2-fluoro-4-(trifluoromethoxy)phenyl]piperidin-1-yl]acetic acid (PubChem CID 174645138) has the molecular formula C14H15F4NO3 and a molecular weight of 321.27 g/mol. Its IUPAC name is 2-[2-[2-fluoro-4-(trifluoromethoxy)phenyl]piperidin-1-yl]acetic acid.
| Compound Name | 2-[2-[2-fluoro-4-(trifluoromethoxy)phenyl]piperidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 174645138 |
| Molecular Formula | C14H15F4NO3 |
| Molecular Weight | 321.27 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 2-[2-[2-fluoro-4-(trifluoromethoxy)phenyl]piperidin-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCCCC1c1ccc(OC(F)(F)F)cc1F |
| InChI | InChI=1S/C14H15F4NO3/c15-11-7-9(22-14(16,17)18)4-5-10(11)12-3-1-2-6-19(12)8-13(20)21/h4-5,7,12H,1-3,6,8H2,(H,20,21) |
| InChIKey | XNEHSYGOAICRNY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.27 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |