C15H15F4NO5 — CID 66731655
2-[2-fluoro-4-(trifluoromethoxy)phenyl]-1-methoxycarbonylpiperidine-4-carboxylic acid (PubChem CID 66731655) has the molecular formula C15H15F4NO5 and a molecular weight of 365.28 g/mol. Its IUPAC name is 2-[2-fluoro-4-(trifluoromethoxy)phenyl]-1-methoxycarbonylpiperidine-4-carboxylic acid.
| Compound Name | 2-[2-fluoro-4-(trifluoromethoxy)phenyl]-1-methoxycarbonylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 66731655 |
| Molecular Formula | C15H15F4NO5 |
| Molecular Weight | 365.28 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 2-[2-fluoro-4-(trifluoromethoxy)phenyl]-1-methoxycarbonylpiperidine-4-carboxylic acid |
| SMILES | COC(=O)N1CCC(C(=O)O)CC1c1ccc(OC(F)(F)F)cc1F |
| InChI | InChI=1S/C15H15F4NO5/c1-24-14(23)20-5-4-8(13(21)22)6-12(20)10-3-2-9(7-11(10)16)25-15(17,18)19/h2-3,7-8,12H,4-6H2,1H3,(H,21,22) |
| InChIKey | NIJUQSKJHMSVNU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.28 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |