C16H18F3NO5 — CID 66732042
1-methoxycarbonyl-2-[[4-(trifluoromethoxy)phenyl]methyl]piperidine-4-carboxylic acid (PubChem CID 66732042) has the molecular formula C16H18F3NO5 and a molecular weight of 361.32 g/mol. Its IUPAC name is 1-methoxycarbonyl-2-[[4-(trifluoromethoxy)phenyl]methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-methoxycarbonyl-2-[[4-(trifluoromethoxy)phenyl]methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 66732042 |
| Molecular Formula | C16H18F3NO5 |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 1-methoxycarbonyl-2-[[4-(trifluoromethoxy)phenyl]methyl]piperidine-4-carboxylic acid |
| SMILES | COC(=O)N1CCC(C(=O)O)CC1Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H18F3NO5/c1-24-15(23)20-7-6-11(14(21)22)9-12(20)8-10-2-4-13(5-3-10)25-16(17,18)19/h2-5,11-12H,6-9H2,1H3,(H,21,22) |
| InChIKey | WHGYIIPRSBPGLD-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |