C19H22F3NO6 — CID 154184268
1-O-ethyl 3-O-[2-[[4-(trifluoromethoxy)phenyl]methyl]piperidine-1-carbonyl] propanedioate (PubChem CID 154184268) has the molecular formula C19H22F3NO6 and a molecular weight of 417.38 g/mol. Its IUPAC name is 1-O-ethyl 3-O-[2-[[4-(trifluoromethoxy)phenyl]methyl]piperidine-1-carbonyl] propanedioate.
| Compound Name | 1-O-ethyl 3-O-[2-[[4-(trifluoromethoxy)phenyl]methyl]piperidine-1-carbonyl] propanedioate |
|---|---|
| PubChem CID | 154184268 |
| Molecular Formula | C19H22F3NO6 |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 1-O-ethyl 3-O-[2-[[4-(trifluoromethoxy)phenyl]methyl]piperidine-1-carbonyl] propanedioate |
| SMILES | CCOC(=O)CC(=O)OC(=O)N1CCCCC1Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H22F3NO6/c1-2-27-16(24)12-17(25)28-18(26)23-10-4-3-5-14(23)11-13-6-8-15(9-7-13)29-19(20,21)22/h6-9,14H,2-5,10-12H2,1H3 |
| InChIKey | GIYOALHMEIDZAS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|