C16H18F3NO4 — CID 66731832
1-methoxycarbonyl-2-[[3-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxylic acid (PubChem CID 66731832) has the molecular formula C16H18F3NO4 and a molecular weight of 345.32 g/mol. Its IUPAC name is 1-methoxycarbonyl-2-[[3-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-methoxycarbonyl-2-[[3-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 66731832 |
| Molecular Formula | C16H18F3NO4 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 1-methoxycarbonyl-2-[[3-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxylic acid |
| SMILES | COC(=O)N1CCC(C(=O)O)CC1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H18F3NO4/c1-24-15(23)20-6-5-11(14(21)22)9-13(20)8-10-3-2-4-12(7-10)16(17,18)19/h2-4,7,11,13H,5-6,8-9H2,1H3,(H,21,22) |
| InChIKey | KLMBEODDGGDXJU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |