C19H22F3NO5 — CID 141283032
(2R,4R)-4-(3-ethoxy-3-oxopropanoyl)-2-[[3-(trifluoromethyl)phenyl]methyl]piperidine-1-carboxylic acid (PubChem CID 141283032) has the molecular formula C19H22F3NO5 and a molecular weight of 401.38 g/mol. Its IUPAC name is (2R,4R)-4-(3-ethoxy-3-oxopropanoyl)-2-[[3-(trifluoromethyl)phenyl]methyl]piperidine-1-carboxylic acid.
| Compound Name | (2R,4R)-4-(3-ethoxy-3-oxopropanoyl)-2-[[3-(trifluoromethyl)phenyl]methyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 141283032 |
| Molecular Formula | C19H22F3NO5 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | (2R,4R)-4-(3-ethoxy-3-oxopropanoyl)-2-[[3-(trifluoromethyl)phenyl]methyl]piperidine-1-carboxylic acid |
| SMILES | CCOC(=O)CC(=O)[C@@H]1CCN(C(=O)O)[C@@H](Cc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C19H22F3NO5/c1-2-28-17(25)11-16(24)13-6-7-23(18(26)27)15(10-13)9-12-4-3-5-14(8-12)19(20,21)22/h3-5,8,13,15H,2,6-7,9-11H2,1H3,(H,26,27)/t13-,15+/m1/s1 |
| InChIKey | RGZFSMPWPQYNHS-HIFRSBDPSA-N |
| XLogP | 3.53 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|