C18H20F3NO5 — CID 123828852
4-(3-ethoxy-3-oxopropanoyl)-2-[4-(trifluoromethyl)phenyl]piperidine-1-carboxylic acid (PubChem CID 123828852) has the molecular formula C18H20F3NO5 and a molecular weight of 387.35 g/mol. Its IUPAC name is 4-(3-ethoxy-3-oxopropanoyl)-2-[4-(trifluoromethyl)phenyl]piperidine-1-carboxylic acid.
| Compound Name | 4-(3-ethoxy-3-oxopropanoyl)-2-[4-(trifluoromethyl)phenyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 123828852 |
| Molecular Formula | C18H20F3NO5 |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 4-(3-ethoxy-3-oxopropanoyl)-2-[4-(trifluoromethyl)phenyl]piperidine-1-carboxylic acid |
| SMILES | CCOC(=O)CC(=O)C1CCN(C(=O)O)C(c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C18H20F3NO5/c1-2-27-16(24)10-15(23)12-7-8-22(17(25)26)14(9-12)11-3-5-13(6-4-11)18(19,20)21/h3-6,12,14H,2,7-10H2,1H3,(H,25,26) |
| InChIKey | UCLVMJGCXQSTLQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|