C18H21F2NO5 — CID 123225680
2-[(2,4-difluorophenyl)methyl]-4-(3-ethoxy-3-oxopropanoyl)piperidine-1-carboxylic acid (PubChem CID 123225680) has the molecular formula C18H21F2NO5 and a molecular weight of 369.36 g/mol. Its IUPAC name is 2-[(2,4-difluorophenyl)methyl]-4-(3-ethoxy-3-oxopropanoyl)piperidine-1-carboxylic acid.
| Compound Name | 2-[(2,4-difluorophenyl)methyl]-4-(3-ethoxy-3-oxopropanoyl)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 123225680 |
| Molecular Formula | C18H21F2NO5 |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 2-[(2,4-difluorophenyl)methyl]-4-(3-ethoxy-3-oxopropanoyl)piperidine-1-carboxylic acid |
| SMILES | CCOC(=O)CC(=O)C1CCN(C(=O)O)C(Cc2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C18H21F2NO5/c1-2-26-17(23)10-16(22)12-5-6-21(18(24)25)14(8-12)7-11-3-4-13(19)9-15(11)20/h3-4,9,12,14H,2,5-8,10H2,1H3,(H,24,25) |
| InChIKey | YDROUHPZVBXTHZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|