C21H31NO3 — CID 66732538
ethyl 3-[(2S,4S)-1-methyl-2-(2-methyl-2-phenylpropyl)piperidin-4-yl]-3-oxopropanoate (PubChem CID 66732538) has the molecular formula C21H31NO3 and a molecular weight of 345.48 g/mol. Its IUPAC name is ethyl 3-[(2S,4S)-1-methyl-2-(2-methyl-2-phenylpropyl)piperidin-4-yl]-3-oxopropanoate.
| Compound Name | ethyl 3-[(2S,4S)-1-methyl-2-(2-methyl-2-phenylpropyl)piperidin-4-yl]-3-oxopropanoate |
|---|---|
| PubChem CID | 66732538 |
| Molecular Formula | C21H31NO3 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | ethyl 3-[(2S,4S)-1-methyl-2-(2-methyl-2-phenylpropyl)piperidin-4-yl]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)[C@H]1CCN(C)[C@H](CC(C)(C)c2ccccc2)C1 |
| InChI | InChI=1S/C21H31NO3/c1-5-25-20(24)14-19(23)16-11-12-22(4)18(13-16)15-21(2,3)17-9-7-6-8-10-17/h6-10,16,18H,5,11-15H2,1-4H3/t16-,18-/m0/s1 |
| InChIKey | DHLLFCDMHWWXOR-WMZOPIPTSA-N |
| XLogP | 3.59 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|