C21H29NO5 — CID 123644575
2-(3-tert-butylphenyl)-4-(3-ethoxy-3-oxopropanoyl)piperidine-1-carboxylic acid (PubChem CID 123644575) has the molecular formula C21H29NO5 and a molecular weight of 375.47 g/mol. Its IUPAC name is 2-(3-tert-butylphenyl)-4-(3-ethoxy-3-oxopropanoyl)piperidine-1-carboxylic acid.
| Compound Name | 2-(3-tert-butylphenyl)-4-(3-ethoxy-3-oxopropanoyl)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 123644575 |
| Molecular Formula | C21H29NO5 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 2-(3-tert-butylphenyl)-4-(3-ethoxy-3-oxopropanoyl)piperidine-1-carboxylic acid |
| SMILES | CCOC(=O)CC(=O)C1CCN(C(=O)O)C(c2cccc(C(C)(C)C)c2)C1 |
| InChI | InChI=1S/C21H29NO5/c1-5-27-19(24)13-18(23)15-9-10-22(20(25)26)17(12-15)14-7-6-8-16(11-14)21(2,3)4/h6-8,11,15,17H,5,9-10,12-13H2,1-4H3,(H,25,26) |
| InChIKey | UBFAKLLNXHMGHL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|