C19H22F3NO5 — CID 66734769
methyl (2S,4S)-2-[(3,5-difluorophenyl)-fluoromethyl]-4-(3-ethoxy-3-oxopropanoyl)piperidine-1-carboxylate (PubChem CID 66734769) has the molecular formula C19H22F3NO5 and a molecular weight of 401.38 g/mol. Its IUPAC name is methyl (2S,4S)-2-[(3,5-difluorophenyl)-fluoromethyl]-4-(3-ethoxy-3-oxopropanoyl)piperidine-1-carboxylate.
| Compound Name | methyl (2S,4S)-2-[(3,5-difluorophenyl)-fluoromethyl]-4-(3-ethoxy-3-oxopropanoyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 66734769 |
| Molecular Formula | C19H22F3NO5 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | methyl (2S,4S)-2-[(3,5-difluorophenyl)-fluoromethyl]-4-(3-ethoxy-3-oxopropanoyl)piperidine-1-carboxylate |
| SMILES | CCOC(=O)CC(=O)[C@H]1CCN(C(=O)OC)C(C(F)c2cc(F)cc(F)c2)C1 |
| InChI | InChI=1S/C19H22F3NO5/c1-3-28-17(25)10-16(24)11-4-5-23(19(26)27-2)15(8-11)18(22)12-6-13(20)9-14(21)7-12/h6-7,9,11,15,18H,3-5,8,10H2,1-2H3/t11-,15?,18?/m0/s1 |
| InChIKey | PLILVDITHYWLPG-RVNWNWAHSA-N |
| XLogP | 3.34 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|