C15H16ClF2NO4 — CID 66734743
dimethyl 2-(4-chloro-3,5-difluorophenyl)piperidine-1,4-dicarboxylate (PubChem CID 66734743) has the molecular formula C15H16ClF2NO4 and a molecular weight of 347.75 g/mol. Its IUPAC name is dimethyl 2-(4-chloro-3,5-difluorophenyl)piperidine-1,4-dicarboxylate.
| Compound Name | dimethyl 2-(4-chloro-3,5-difluorophenyl)piperidine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 66734743 |
| Molecular Formula | C15H16ClF2NO4 |
| Molecular Weight | 347.75 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | dimethyl 2-(4-chloro-3,5-difluorophenyl)piperidine-1,4-dicarboxylate |
| SMILES | COC(=O)C1CCN(C(=O)OC)C(c2cc(F)c(Cl)c(F)c2)C1 |
| InChI | InChI=1S/C15H16ClF2NO4/c1-22-14(20)8-3-4-19(15(21)23-2)12(7-8)9-5-10(17)13(16)11(18)6-9/h5-6,8,12H,3-4,7H2,1-2H3 |
| InChIKey | GABCAAMKRMNLIC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.75 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|