C16H15ClF2N2O4 — CID 131730423
methyl (2R,4R)-2-(4-chloro-3,5-difluorophenyl)-4-(3-oxo-1,2-oxazol-5-yl)piperidine-1-carboxylate (PubChem CID 131730423) has the molecular formula C16H15ClF2N2O4 and a molecular weight of 372.76 g/mol. Its IUPAC name is methyl (2R,4R)-2-(4-chloro-3,5-difluorophenyl)-4-(3-oxo-1,2-oxazol-5-yl)piperidine-1-carboxylate.
| Compound Name | methyl (2R,4R)-2-(4-chloro-3,5-difluorophenyl)-4-(3-oxo-1,2-oxazol-5-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 131730423 |
| Molecular Formula | C16H15ClF2N2O4 |
| Molecular Weight | 372.76 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | methyl (2R,4R)-2-(4-chloro-3,5-difluorophenyl)-4-(3-oxo-1,2-oxazol-5-yl)piperidine-1-carboxylate |
| SMILES | COC(=O)N1CC[C@@H](c2cc(=O)[nH]o2)C[C@@H]1c1cc(F)c(Cl)c(F)c1 |
| InChI | InChI=1S/C16H15ClF2N2O4/c1-24-16(23)21-3-2-8(13-7-14(22)20-25-13)6-12(21)9-4-10(18)15(17)11(19)5-9/h4-5,7-8,12H,2-3,6H2,1H3,(H,20,22)/t8-,12-/m1/s1 |
| InChIKey | AAAIFYUBHAUGQR-PRHODGIISA-N |
| XLogP | 3.59 |
| TPSA | 75.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.76 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|