C29H32O7 — CID 177152802
methoxymethyl 2-[(2-hydroxy-3,6-dimethyl-4-phenylmethoxybenzoyl)oxymethyl]-3,5,6-trimethylbenzoate (PubChem CID 177152802) has the molecular formula C29H32O7 and a molecular weight of 492.57 g/mol. Its IUPAC name is methoxymethyl 2-[(2-hydroxy-3,6-dimethyl-4-phenylmethoxybenzoyl)oxymethyl]-3,5,6-trimethylbenzoate.
| Compound Name | methoxymethyl 2-[(2-hydroxy-3,6-dimethyl-4-phenylmethoxybenzoyl)oxymethyl]-3,5,6-trimethylbenzoate |
|---|---|
| PubChem CID | 177152802 |
| Molecular Formula | C29H32O7 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | methoxymethyl 2-[(2-hydroxy-3,6-dimethyl-4-phenylmethoxybenzoyl)oxymethyl]-3,5,6-trimethylbenzoate |
| SMILES | COCOC(=O)c1c(C)c(C)cc(C)c1COC(=O)c1c(C)cc(OCc2ccccc2)c(C)c1O |
| InChI | InChI=1S/C29H32O7/c1-17-12-18(2)23(26(20(17)4)29(32)36-16-33-6)15-35-28(31)25-19(3)13-24(21(5)27(25)30)34-14-22-10-8-7-9-11-22/h7-13,30H,14-16H2,1-6H3 |
| InChIKey | YJFZCWPCHBGUAV-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|