C17H16O6 — CID 10860036
2-hydroxy-4-methoxy-6-methyl-3-phenylmethoxycarbonylbenzoic acid (PubChem CID 10860036) has the molecular formula C17H16O6 and a molecular weight of 316.31 g/mol. Its IUPAC name is 2-hydroxy-4-methoxy-6-methyl-3-phenylmethoxycarbonylbenzoic acid.
| Compound Name | 2-hydroxy-4-methoxy-6-methyl-3-phenylmethoxycarbonylbenzoic acid |
|---|---|
| PubChem CID | 10860036 |
| Molecular Formula | C17H16O6 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 2-hydroxy-4-methoxy-6-methyl-3-phenylmethoxycarbonylbenzoic acid |
| SMILES | COc1cc(C)c(C(=O)O)c(O)c1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H16O6/c1-10-8-12(22-2)14(15(18)13(10)16(19)20)17(21)23-9-11-6-4-3-5-7-11/h3-8,18H,9H2,1-2H3,(H,19,20) |
| InChIKey | FORLPAOOSIDMNP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |