C20H24O4 — CID 11088753
benzyl 4-hydroxy-2-methoxy-6-pentylbenzoate (PubChem CID 11088753) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is benzyl 4-hydroxy-2-methoxy-6-pentylbenzoate.
| Compound Name | benzyl 4-hydroxy-2-methoxy-6-pentylbenzoate |
|---|---|
| PubChem CID | 11088753 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | benzyl 4-hydroxy-2-methoxy-6-pentylbenzoate |
| SMILES | CCCCCc1cc(O)cc(OC)c1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H24O4/c1-3-4-6-11-16-12-17(21)13-18(23-2)19(16)20(22)24-14-15-9-7-5-8-10-15/h5,7-10,12-13,21H,3-4,6,11,14H2,1-2H3 |
| InChIKey | SOOADOAQKGBDHK-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|