C32H36N2O5 — CID 177190798
methoxymethyl 3-ethyl-2,5,6-trimethyl-4-(2,5,8-trimethyl-7-phenylmethoxyquinazolin-4-yl)oxybenzoate (PubChem CID 177190798) has the molecular formula C32H36N2O5 and a molecular weight of 528.65 g/mol. Its IUPAC name is methoxymethyl 3-ethyl-2,5,6-trimethyl-4-(2,5,8-trimethyl-7-phenylmethoxyquinazolin-4-yl)oxybenzoate.
| Compound Name | methoxymethyl 3-ethyl-2,5,6-trimethyl-4-(2,5,8-trimethyl-7-phenylmethoxyquinazolin-4-yl)oxybenzoate |
|---|---|
| PubChem CID | 177190798 |
| Molecular Formula | C32H36N2O5 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | methoxymethyl 3-ethyl-2,5,6-trimethyl-4-(2,5,8-trimethyl-7-phenylmethoxyquinazolin-4-yl)oxybenzoate |
| SMILES | CCc1c(C)c(C(=O)OCOC)c(C)c(C)c1Oc1nc(C)nc2c(C)c(OCc3ccccc3)cc(C)c12 |
| InChI | InChI=1S/C32H36N2O5/c1-9-25-21(5)28(32(35)38-17-36-8)19(3)20(4)30(25)39-31-27-18(2)15-26(22(6)29(27)33-23(7)34-31)37-16-24-13-11-10-12-14-24/h10-15H,9,16-17H2,1-8H3 |
| InChIKey | YSADJUCFQCUCEI-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 79.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|