C23H28O5 — CID 177152762
methoxymethyl 3-(3-methoxyprop-1-en-2-yl)-2,5,6-trimethyl-4-phenylmethoxybenzoate (PubChem CID 177152762) has the molecular formula C23H28O5 and a molecular weight of 384.47 g/mol. Its IUPAC name is methoxymethyl 3-(3-methoxyprop-1-en-2-yl)-2,5,6-trimethyl-4-phenylmethoxybenzoate.
| Compound Name | methoxymethyl 3-(3-methoxyprop-1-en-2-yl)-2,5,6-trimethyl-4-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 177152762 |
| Molecular Formula | C23H28O5 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | methoxymethyl 3-(3-methoxyprop-1-en-2-yl)-2,5,6-trimethyl-4-phenylmethoxybenzoate |
| SMILES | C=C(COC)c1c(C)c(C(=O)OCOC)c(C)c(C)c1OCc1ccccc1 |
| InChI | InChI=1S/C23H28O5/c1-15(12-25-5)20-18(4)21(23(24)28-14-26-6)16(2)17(3)22(20)27-13-19-10-8-7-9-11-19/h7-11H,1,12-14H2,2-6H3 |
| InChIKey | ILHZHUQTMWMNEZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|