C17H18BrNO3 — CID 87130031
5-bromo-N-methoxy-2,3-dimethyl-4-phenylmethoxybenzamide (PubChem CID 87130031) has the molecular formula C17H18BrNO3 and a molecular weight of 364.24 g/mol. Its IUPAC name is 5-bromo-N-methoxy-2,3-dimethyl-4-phenylmethoxybenzamide.
| Compound Name | 5-bromo-N-methoxy-2,3-dimethyl-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 87130031 |
| Molecular Formula | C17H18BrNO3 |
| Molecular Weight | 364.24 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | 5-bromo-N-methoxy-2,3-dimethyl-4-phenylmethoxybenzamide |
| SMILES | CONC(=O)c1cc(Br)c(OCc2ccccc2)c(C)c1C |
| InChI | InChI=1S/C17H18BrNO3/c1-11-12(2)16(22-10-13-7-5-4-6-8-13)15(18)9-14(11)17(20)19-21-3/h4-9H,10H2,1-3H3,(H,19,20) |
| InChIKey | XOABLTQKYLTDAO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.24 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|