C35H47BrO5Si — CID 123962491
methyl 5-bromo-2,4-bis(phenylmethoxy)-3-(tritert-butylsilyloxymethyl)benzoate (PubChem CID 123962491) has the molecular formula C35H47BrO5Si and a molecular weight of 655.75 g/mol. Its IUPAC name is methyl 5-bromo-2,4-bis(phenylmethoxy)-3-(tritert-butylsilyloxymethyl)benzoate.
| Compound Name | methyl 5-bromo-2,4-bis(phenylmethoxy)-3-(tritert-butylsilyloxymethyl)benzoate |
|---|---|
| PubChem CID | 123962491 |
| Molecular Formula | C35H47BrO5Si |
| Molecular Weight | 655.75 g/mol |
| Exact Mass | 654.24 |
| IUPAC Name | methyl 5-bromo-2,4-bis(phenylmethoxy)-3-(tritert-butylsilyloxymethyl)benzoate |
| SMILES | COC(=O)c1cc(Br)c(OCc2ccccc2)c(CO[Si](C(C)(C)C)(C(C)(C)C)C(C)(C)C)c1OCc1ccccc1 |
| InChI | InChI=1S/C35H47BrO5Si/c1-33(2,3)42(34(4,5)6,35(7,8)9)41-24-28-30(39-22-25-17-13-11-14-18-25)27(32(37)38-10)21-29(36)31(28)40-23-26-19-15-12-16-20-26/h11-21H,22-24H2,1-10H3 |
| InChIKey | QPJCWAIBQCLZDG-UHFFFAOYSA-N |
| XLogP | 10.26 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.75 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|