C42H34O10 — CID 20755865
dimethyl 4-[3,6-bis(methoxycarbonyl)-2-phenylmethoxynaphthalen-1-yl]-3-phenylmethoxynaphthalene-2,7-dicarboxylate (PubChem CID 20755865) has the molecular formula C42H34O10 and a molecular weight of 698.72 g/mol. Its IUPAC name is dimethyl 4-[3,6-bis(methoxycarbonyl)-2-phenylmethoxynaphthalen-1-yl]-3-phenylmethoxynaphthalene-2,7-dicarboxylate.
| Compound Name | dimethyl 4-[3,6-bis(methoxycarbonyl)-2-phenylmethoxynaphthalen-1-yl]-3-phenylmethoxynaphthalene-2,7-dicarboxylate |
|---|---|
| PubChem CID | 20755865 |
| Molecular Formula | C42H34O10 |
| Molecular Weight | 698.72 g/mol |
| Exact Mass | 698.22 |
| IUPAC Name | dimethyl 4-[3,6-bis(methoxycarbonyl)-2-phenylmethoxynaphthalen-1-yl]-3-phenylmethoxynaphthalene-2,7-dicarboxylate |
| SMILES | COC(=O)c1ccc2c(-c3c(OCc4ccccc4)c(C(=O)OC)cc4cc(C(=O)OC)ccc34)c(OCc3ccccc3)c(C(=O)OC)cc2c1 |
| InChI | InChI=1S/C42H34O10/c1-47-39(43)27-15-17-31-29(19-27)21-33(41(45)49-3)37(51-23-25-11-7-5-8-12-25)35(31)36-32-18-16-28(40(44)48-2)20-30(32)22-34(42(46)50-4)38(36)52-24-26-13-9-6-10-14-26/h5-22H,23-24H2,1-4H3 |
| InChIKey | ZRPHYKPLCJLZRT-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.72 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|