C20H16O5 — CID 19103233
3-(hydroxymethyl)-7-methoxycarbonyl-4-phenylnaphthalene-2-carboxylic acid (PubChem CID 19103233) has the molecular formula C20H16O5 and a molecular weight of 336.34 g/mol. Its IUPAC name is 3-(hydroxymethyl)-7-methoxycarbonyl-4-phenylnaphthalene-2-carboxylic acid.
| Compound Name | 3-(hydroxymethyl)-7-methoxycarbonyl-4-phenylnaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 19103233 |
| Molecular Formula | C20H16O5 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 3-(hydroxymethyl)-7-methoxycarbonyl-4-phenylnaphthalene-2-carboxylic acid |
| SMILES | COC(=O)c1ccc2c(-c3ccccc3)c(CO)c(C(=O)O)cc2c1 |
| InChI | InChI=1S/C20H16O5/c1-25-20(24)13-7-8-15-14(9-13)10-16(19(22)23)17(11-21)18(15)12-5-3-2-4-6-12/h2-10,21H,11H2,1H3,(H,22,23) |
| InChIKey | LVSKQGKFWPDVMA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |