C15H15BrN2O3 — CID 91008132
methyl 2-amino-6-bromo-5-methyl-3-phenylmethoxypyridine-4-carboxylate (PubChem CID 91008132) has the molecular formula C15H15BrN2O3 and a molecular weight of 351.20 g/mol. Its IUPAC name is methyl 2-amino-6-bromo-5-methyl-3-phenylmethoxypyridine-4-carboxylate.
| Compound Name | methyl 2-amino-6-bromo-5-methyl-3-phenylmethoxypyridine-4-carboxylate |
|---|---|
| PubChem CID | 91008132 |
| Molecular Formula | C15H15BrN2O3 |
| Molecular Weight | 351.20 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | methyl 2-amino-6-bromo-5-methyl-3-phenylmethoxypyridine-4-carboxylate |
| SMILES | COC(=O)c1c(C)c(Br)nc(N)c1OCc1ccccc1 |
| InChI | InChI=1S/C15H15BrN2O3/c1-9-11(15(19)20-2)12(14(17)18-13(9)16)21-8-10-6-4-3-5-7-10/h3-7H,8H2,1-2H3,(H2,17,18) |
| InChIKey | JXZZJNKRJJZPQV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.20 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|