C22H23BrN2O3 — CID 177154227
methyl 1-amino-8-bromo-4-phenylmethoxyisoquinoline-3-carboxylate;2-methylprop-1-ene (PubChem CID 177154227) has the molecular formula C22H23BrN2O3 and a molecular weight of 443.34 g/mol. Its IUPAC name is methyl 1-amino-8-bromo-4-phenylmethoxyisoquinoline-3-carboxylate;2-methylprop-1-ene.
| Compound Name | methyl 1-amino-8-bromo-4-phenylmethoxyisoquinoline-3-carboxylate;2-methylprop-1-ene |
|---|---|
| PubChem CID | 177154227 |
| Molecular Formula | C22H23BrN2O3 |
| Molecular Weight | 443.34 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | methyl 1-amino-8-bromo-4-phenylmethoxyisoquinoline-3-carboxylate;2-methylprop-1-ene |
| SMILES | C=C(C)C.COC(=O)c1nc(N)c2c(Br)cccc2c1OCc1ccccc1 |
| InChI | InChI=1S/C18H15BrN2O3.C4H8/c1-23-18(22)15-16(24-10-11-6-3-2-4-7-11)12-8-5-9-13(19)14(12)17(20)21-15;1-4(2)3/h2-9H,10H2,1H3,(H2,20,21);1H2,2-3H3 |
| InChIKey | NPSAAVBJMOUZCX-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.34 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|