C17H14N2O3 — CID 176830175
methyl 4-phenylmethoxy-2,6-naphthyridine-3-carboxylate (PubChem CID 176830175) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is methyl 4-phenylmethoxy-2,6-naphthyridine-3-carboxylate.
| Compound Name | methyl 4-phenylmethoxy-2,6-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 176830175 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | methyl 4-phenylmethoxy-2,6-naphthyridine-3-carboxylate |
| SMILES | COC(=O)c1ncc2ccncc2c1OCc1ccccc1 |
| InChI | InChI=1S/C17H14N2O3/c1-21-17(20)15-16(22-11-12-5-3-2-4-6-12)14-10-18-8-7-13(14)9-19-15/h2-10H,11H2,1H3 |
| InChIKey | RSTBUNJIVDBSDU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |