C18H19NO4 — CID 177153407
ethane;methyl 7-phenylmethoxyfuro[3,2-c]pyridine-6-carboxylate (PubChem CID 177153407) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is ethane;methyl 7-phenylmethoxyfuro[3,2-c]pyridine-6-carboxylate.
| Compound Name | ethane;methyl 7-phenylmethoxyfuro[3,2-c]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 177153407 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | ethane;methyl 7-phenylmethoxyfuro[3,2-c]pyridine-6-carboxylate |
| SMILES | CC.COC(=O)c1ncc2ccoc2c1OCc1ccccc1 |
| InChI | InChI=1S/C16H13NO4.C2H6/c1-19-16(18)13-15(14-12(9-17-13)7-8-20-14)21-10-11-5-3-2-4-6-11;1-2/h2-9H,10H2,1H3;1-2H3 |
| InChIKey | RBSFETKSKMEWFF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |